C23H31N5O7S2 — CID 19943889
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid (PubChem CID 19943889) has the molecular formula C23H31N5O7S2 and a molecular weight of 553.66 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19943889 |
| Molecular Formula | C23H31N5O7S2 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid |
| SMILES | CSCCC(NC(=O)C(CS)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H31N5O7S2/c1-37-7-6-16(21(32)27-17(23(34)35)9-19(29)30)26-22(33)18(11-36)28-20(31)14(24)8-12-10-25-15-5-3-2-4-13(12)15/h2-5,10,14,16-18,25,36H,6-9,11,24H2,1H3,(H,26,33)(H,27,32)(H,28,31)(H,29,30)(H,34,35) |
| InChIKey | UESKHYWCPKJCEV-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 203.71 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|