C30H37N5O8 — CID 19946003
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]butanedioic acid (PubChem CID 19946003) has the molecular formula C30H37N5O8 and a molecular weight of 595.65 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19946003 |
| Molecular Formula | C30H37N5O8 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C30H37N5O8/c1-3-16(2)26(35-27(39)21(31)13-18-15-32-22-7-5-4-6-20(18)22)29(41)33-23(12-17-8-10-19(36)11-9-17)28(40)34-24(30(42)43)14-25(37)38/h4-11,15-16,21,23-24,26,32,36H,3,12-14,31H2,1-2H3,(H,33,41)(H,34,40)(H,35,39)(H,37,38)(H,42,43) |
| InChIKey | HSMGGAHCWYVIKO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |