C26H36N6O8 — CID 19952190
4-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-[[1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-3-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 19952190) has the molecular formula C26H36N6O8 and a molecular weight of 560.61 g/mol. Its IUPAC name is 4-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-[[1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-3-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-[[1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-3-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19952190 |
| Molecular Formula | C26H36N6O8 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 4-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-[[1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-3-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCC(=O)O)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C26H36N6O8/c1-3-14(2)22(25(38)31-20(26(39)40)11-16-12-28-13-29-16)32-24(37)19(8-9-21(34)35)30-23(36)18(27)10-15-4-6-17(33)7-5-15/h4-7,12-14,18-20,22,33H,3,8-11,27H2,1-2H3,(H,28,29)(H,30,36)(H,31,38)(H,32,37)(H,34,35)(H,39,40) |
| InChIKey | AYLMNUFGWNMYMP-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 236.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |