C27H41N9O6 — CID 19953611
2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 19953611) has the molecular formula C27H41N9O6 and a molecular weight of 587.68 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 19953611 |
| Molecular Formula | C27H41N9O6 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.32 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C27H41N9O6/c1-3-15(2)22(36-23(38)19(28)11-16-6-8-18(37)9-7-16)25(40)34-20(5-4-10-32-27(29)30)24(39)35-21(26(41)42)12-17-13-31-14-33-17/h6-9,13-15,19-22,37H,3-5,10-12,28H2,1-2H3,(H,31,33)(H,34,40)(H,35,39)(H,36,38)(H,41,42)(H4,29,30,32) |
| InChIKey | MCQFGDOMUJQADO-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 263.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|