C23H40N10O6 — CID 18480385
2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylpentanoyl]amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18480385) has the molecular formula C23H40N10O6 and a molecular weight of 552.64 g/mol. Its IUPAC name is 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylpentanoyl]amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylpentanoyl]amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18480385 |
| Molecular Formula | C23H40N10O6 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylpentanoyl]amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C23H40N10O6/c1-3-12(2)18(33-19(35)14(24)6-7-17(25)34)21(37)31-15(5-4-8-29-23(26)27)20(36)32-16(22(38)39)9-13-10-28-11-30-13/h10-12,14-16,18H,3-9,24H2,1-2H3,(H2,25,34)(H,28,30)(H,31,37)(H,32,36)(H,33,35)(H,38,39)(H4,26,27,29) |
| InChIKey | NVEQPFNBICIWTL-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 286.79 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|