C22H29N7O7S — CID 19953228
2-[[4-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 19953228) has the molecular formula C22H29N7O7S and a molecular weight of 535.58 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 19953228 |
| Molecular Formula | C22H29N7O7S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 2-[[4-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C22H29N7O7S/c23-14(5-11-1-3-13(30)4-2-11)19(32)27-15(6-12-8-25-10-26-12)20(33)28-16(7-18(24)31)21(34)29-17(9-37)22(35)36/h1-4,8,10,14-17,30,37H,5-7,9,23H2,(H2,24,31)(H,25,26)(H,27,32)(H,28,33)(H,29,34)(H,35,36) |
| InChIKey | PRHLSYCSMGHSPW-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 242.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|