C31H42N6O6S — CID 19955123
6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid (PubChem CID 19955123) has the molecular formula C31H42N6O6S and a molecular weight of 626.78 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19955123 |
| Molecular Formula | C31H42N6O6S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
| SMILES | CSCCC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C31H42N6O6S/c1-44-15-13-25(35-28(39)23(33)16-19-9-11-21(38)12-10-19)29(40)37-27(17-20-18-34-24-7-3-2-6-22(20)24)30(41)36-26(31(42)43)8-4-5-14-32/h2-3,6-7,9-12,18,23,25-27,34,38H,4-5,8,13-17,32-33H2,1H3,(H,35,39)(H,36,41)(H,37,40)(H,42,43) |
| InChIKey | JPEXUKZWSWDSDH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 212.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|