C10H8N2O2 — CID 19957210
4,5-dimethylquinazoline-2,6-dione (PubChem CID 19957210) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is 4,5-dimethylquinazoline-2,6-dione.
| Compound Name | 4,5-dimethylquinazoline-2,6-dione |
|---|---|
| PubChem CID | 19957210 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 4,5-dimethylquinazoline-2,6-dione |
| SMILES | CC1=NC(=O)N=C2C=CC(=O)C(C)=C12 |
| InChI | InChI=1S/C10H8N2O2/c1-5-8(13)4-3-7-9(5)6(2)11-10(14)12-7/h3-4H,1-2H3 |
| InChIKey | QQMANFRURAKMRJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|