C23H22N2O3S — CID 19960278
3-(5-cyano-1-benzothiophen-2-yl)-2-[4-(pyrrolidin-3-ylmethoxy)phenyl]propanoic acid (PubChem CID 19960278) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is 3-(5-cyano-1-benzothiophen-2-yl)-2-[4-(pyrrolidin-3-ylmethoxy)phenyl]propanoic acid.
| Compound Name | 3-(5-cyano-1-benzothiophen-2-yl)-2-[4-(pyrrolidin-3-ylmethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 19960278 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 3-(5-cyano-1-benzothiophen-2-yl)-2-[4-(pyrrolidin-3-ylmethoxy)phenyl]propanoic acid |
| SMILES | N#Cc1ccc2sc(CC(C(=O)O)c3ccc(OCC4CCNC4)cc3)cc2c1 |
| InChI | InChI=1S/C23H22N2O3S/c24-12-15-1-6-22-18(9-15)10-20(29-22)11-21(23(26)27)17-2-4-19(5-3-17)28-14-16-7-8-25-13-16/h1-6,9-10,16,21,25H,7-8,11,13-14H2,(H,26,27) |
| InChIKey | CTVCYPDCZBRWHF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |