C20H22FNOS — CID 19963570
4-[6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptan-3-yl]-1-thiophen-2-ylbutan-1-one (PubChem CID 19963570) has the molecular formula C20H22FNOS and a molecular weight of 343.47 g/mol. Its IUPAC name is 4-[6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptan-3-yl]-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-[6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptan-3-yl]-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 19963570 |
| Molecular Formula | C20H22FNOS |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-[6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptan-3-yl]-1-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCN1CC2CC(c3ccc(F)cc3)C2C1)c1cccs1 |
| InChI | InChI=1S/C20H22FNOS/c21-16-7-5-14(6-8-16)17-11-15-12-22(13-18(15)17)9-1-3-19(23)20-4-2-10-24-20/h2,4-8,10,15,17-18H,1,3,9,11-13H2 |
| InChIKey | IEWMSXRYDTXBRF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |