About 2-methylhexa-1,5-diene
2-methylhexa-1,5-diene (PubChem CID 19965) has the molecular formula C7H12
and a molecular weight of 96.17 g/mol. Its IUPAC name is 2-methylhexa-1,5-diene.
Molecular Properties
| Compound Name | 2-methylhexa-1,5-diene |
| PubChem CID | 19965 |
| Molecular Formula | C7H12 |
| Molecular Weight | 96.17 g/mol |
| Exact Mass | 96.09 |
| IUPAC Name | 2-methylhexa-1,5-diene |
| SMILES | C=CCCC(=C)C |
| InChI | InChI=1S/C7H12/c1-4-5-6-7(2)3/h4H,1-2,5-6H2,3H3 |
| InChIKey | SLQMKNPIYMOEGB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhexa-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexa-1,5-diene?
The IUPAC name of 2-methylhexa-1,5-diene (CID 19965) is 2-methylhexa-1,5-diene.
What is the SMILES notation for 2-methylhexa-1,5-diene?
The canonical SMILES for 2-methylhexa-1,5-diene is C=CCCC(=C)C.
What is the InChIKey of 2-methylhexa-1,5-diene?
The InChIKey is SLQMKNPIYMOEGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12/c1-4-5-6-7(2)3/h4H,1-2,5-6H2,3H3.
What are the key properties of 2-methylhexa-1,5-diene?
2-methylhexa-1,5-diene has a molecular weight of 96.17 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexa-1,5-diene is sourced from PubChem (CID 19965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).