About 3-methylidenepentane
3-methylidenepentane (PubChem CID 12970) has the molecular formula C6H12
and a molecular weight of 84.16 g/mol. Its IUPAC name is 3-methylidenepentane.
Molecular Properties
| Compound Name | 3-methylidenepentane |
| PubChem CID | 12970 |
| Molecular Formula | C6H12 |
| Molecular Weight | 84.16 g/mol |
| Exact Mass | 84.09 |
| IUPAC Name | 3-methylidenepentane |
| SMILES | C=C(CC)CC |
| InChI | InChI=1S/C6H12/c1-4-6(3)5-2/h3-5H2,1-2H3 |
| InChIKey | RYKZRKKEYSRDNF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.16 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylidenepentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidenepentane?
The IUPAC name of 3-methylidenepentane (CID 12970) is 3-methylidenepentane.
What is the SMILES notation for 3-methylidenepentane?
The canonical SMILES for 3-methylidenepentane is C=C(CC)CC.
What is the InChIKey of 3-methylidenepentane?
The InChIKey is RYKZRKKEYSRDNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12/c1-4-6(3)5-2/h3-5H2,1-2H3.
What are the key properties of 3-methylidenepentane?
3-methylidenepentane has a molecular weight of 84.16 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidenepentane is sourced from PubChem (CID 12970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).