C16H18INO3S — CID 19965164
2-[4-(2,2-dimethylpropoxy)-3-iodophenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 19965164) has the molecular formula C16H18INO3S and a molecular weight of 431.30 g/mol. Its IUPAC name is 2-[4-(2,2-dimethylpropoxy)-3-iodophenyl]-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[4-(2,2-dimethylpropoxy)-3-iodophenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19965164 |
| Molecular Formula | C16H18INO3S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 2-[4-(2,2-dimethylpropoxy)-3-iodophenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(-c2ccc(OCC(C)(C)C)c(I)c2)sc1C(=O)O |
| InChI | InChI=1S/C16H18INO3S/c1-9-13(15(19)20)22-14(18-9)10-5-6-12(11(17)7-10)21-8-16(2,3)4/h5-7H,8H2,1-4H3,(H,19,20) |
| InChIKey | OJYODLXUWJVGFL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|