C3H11N5 — CID 19966848
1,2-diamino-1-ethylguanidine (PubChem CID 19966848) has the molecular formula C3H11N5 and a molecular weight of 117.16 g/mol. Its IUPAC name is 1,2-diamino-1-ethylguanidine.
| Compound Name | 1,2-diamino-1-ethylguanidine |
|---|---|
| PubChem CID | 19966848 |
| Molecular Formula | C3H11N5 |
| Molecular Weight | 117.16 g/mol |
| Exact Mass | 117.10 |
| IUPAC Name | 1,2-diamino-1-ethylguanidine |
| SMILES | CCN(N)/C(N)=N\N |
| InChI | InChI=1S/C3H11N5/c1-2-8(6)3(4)7-5/h2,5-6H2,1H3,(H2,4,7) |
| InChIKey | IKCJLODFEPSDEL-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.16 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|