C15H8F6O2 — CID 19967847
1-[3-fluoro-4-[fluoro-(2,3,4,5-tetrafluorophenyl)methoxy]phenyl]ethanone (PubChem CID 19967847) has the molecular formula C15H8F6O2 and a molecular weight of 334.22 g/mol. Its IUPAC name is 1-[3-fluoro-4-[fluoro-(2,3,4,5-tetrafluorophenyl)methoxy]phenyl]ethanone.
| Compound Name | 1-[3-fluoro-4-[fluoro-(2,3,4,5-tetrafluorophenyl)methoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 19967847 |
| Molecular Formula | C15H8F6O2 |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-[3-fluoro-4-[fluoro-(2,3,4,5-tetrafluorophenyl)methoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OC(F)c2cc(F)c(F)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C15H8F6O2/c1-6(22)7-2-3-11(9(16)4-7)23-15(21)8-5-10(17)13(19)14(20)12(8)18/h2-5,15H,1H3 |
| InChIKey | LOCYIJWEJMIIOJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|