C16H11F5O2 — CID 19967840
1-[4-[fluoro-(2,3,4,5-tetrafluorophenyl)methoxy]-3-methylphenyl]ethanone (PubChem CID 19967840) has the molecular formula C16H11F5O2 and a molecular weight of 330.25 g/mol. Its IUPAC name is 1-[4-[fluoro-(2,3,4,5-tetrafluorophenyl)methoxy]-3-methylphenyl]ethanone.
| Compound Name | 1-[4-[fluoro-(2,3,4,5-tetrafluorophenyl)methoxy]-3-methylphenyl]ethanone |
|---|---|
| PubChem CID | 19967840 |
| Molecular Formula | C16H11F5O2 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 1-[4-[fluoro-(2,3,4,5-tetrafluorophenyl)methoxy]-3-methylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(OC(F)c2cc(F)c(F)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C16H11F5O2/c1-7-5-9(8(2)22)3-4-12(7)23-16(21)10-6-11(17)14(19)15(20)13(10)18/h3-6,16H,1-2H3 |
| InChIKey | SRTICXCAFIZDGD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|