About chloro prop-1-en-2-yl carbonate
chloro prop-1-en-2-yl carbonate (PubChem CID 19969150) has the molecular formula C4H5ClO3
and a molecular weight of 136.53 g/mol. Its IUPAC name is chloro prop-1-en-2-yl carbonate.
Molecular Properties
| Compound Name | chloro prop-1-en-2-yl carbonate |
| PubChem CID | 19969150 |
| Molecular Formula | C4H5ClO3 |
| Molecular Weight | 136.53 g/mol |
| Exact Mass | 135.99 |
| IUPAC Name | chloro prop-1-en-2-yl carbonate |
| SMILES | C=C(C)OC(=O)OCl |
| InChI | InChI=1S/C4H5ClO3/c1-3(2)7-4(6)8-5/h1H2,2H3 |
| InChIKey | DEQYUXVGFIZQBU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze chloro prop-1-en-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro prop-1-en-2-yl carbonate?
The IUPAC name of chloro prop-1-en-2-yl carbonate (CID 19969150) is chloro prop-1-en-2-yl carbonate.
What is the SMILES notation for chloro prop-1-en-2-yl carbonate?
The canonical SMILES for chloro prop-1-en-2-yl carbonate is C=C(C)OC(=O)OCl.
What is the InChIKey of chloro prop-1-en-2-yl carbonate?
The InChIKey is DEQYUXVGFIZQBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClO3/c1-3(2)7-4(6)8-5/h1H2,2H3.
What are the key properties of chloro prop-1-en-2-yl carbonate?
chloro prop-1-en-2-yl carbonate has a molecular weight of 136.53 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloro prop-1-en-2-yl carbonate is sourced from PubChem (CID 19969150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).