About methanol;prop-1-en-2-yl acetate
methanol;prop-1-en-2-yl acetate (PubChem CID 87442615) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is methanol;prop-1-en-2-yl acetate.
Molecular Properties
| Compound Name | methanol;prop-1-en-2-yl acetate |
| PubChem CID | 87442615 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | methanol;prop-1-en-2-yl acetate |
| SMILES | C=C(C)OC(C)=O.CO |
| InChI | InChI=1S/C5H8O2.CH4O/c1-4(2)7-5(3)6;1-2/h1H2,2-3H3;2H,1H3 |
| InChIKey | VKYZNZCEOCXNRD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze methanol;prop-1-en-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;prop-1-en-2-yl acetate?
The IUPAC name of methanol;prop-1-en-2-yl acetate (CID 87442615) is methanol;prop-1-en-2-yl acetate.
What is the SMILES notation for methanol;prop-1-en-2-yl acetate?
The canonical SMILES for methanol;prop-1-en-2-yl acetate is C=C(C)OC(C)=O.CO.
What is the InChIKey of methanol;prop-1-en-2-yl acetate?
The InChIKey is VKYZNZCEOCXNRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.CH4O/c1-4(2)7-5(3)6;1-2/h1H2,2-3H3;2H,1H3.
What are the key properties of methanol;prop-1-en-2-yl acetate?
methanol;prop-1-en-2-yl acetate has a molecular weight of 132.16 g/mol, XLogP of 0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;prop-1-en-2-yl acetate is sourced from PubChem (CID 87442615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).