C25H30N2O5 — CID 19969576
ethyl 2-benzyl-5-(2-methylpropyl)-3,6-dioxo-4-phenylmethoxypiperazine-2-carboxylate (PubChem CID 19969576) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is ethyl 2-benzyl-5-(2-methylpropyl)-3,6-dioxo-4-phenylmethoxypiperazine-2-carboxylate.
| Compound Name | ethyl 2-benzyl-5-(2-methylpropyl)-3,6-dioxo-4-phenylmethoxypiperazine-2-carboxylate |
|---|---|
| PubChem CID | 19969576 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | ethyl 2-benzyl-5-(2-methylpropyl)-3,6-dioxo-4-phenylmethoxypiperazine-2-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2)NC(=O)C(CC(C)C)N(OCc2ccccc2)C1=O |
| InChI | InChI=1S/C25H30N2O5/c1-4-31-24(30)25(16-19-11-7-5-8-12-19)23(29)27(21(15-18(2)3)22(28)26-25)32-17-20-13-9-6-10-14-20/h5-14,18,21H,4,15-17H2,1-3H3,(H,26,28) |
| InChIKey | YOSZKYQPEONZLY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|