About 1-methylcarbazol-4-one
1-methylcarbazol-4-one (PubChem CID 19969783) has the molecular formula C13H9NO
and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-methylcarbazol-4-one.
Molecular Properties
| Compound Name | 1-methylcarbazol-4-one |
| PubChem CID | 19969783 |
| Molecular Formula | C13H9NO |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 1-methylcarbazol-4-one |
| SMILES | CC1=C2N=c3ccccc3=C2C(=O)C=C1 |
| InChI | InChI=1S/C13H9NO/c1-8-6-7-11(15)12-9-4-2-3-5-10(9)14-13(8)12/h2-7H,1H3 |
| InChIKey | VNHXNDULTGGTII-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylcarbazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcarbazol-4-one?
The IUPAC name of 1-methylcarbazol-4-one (CID 19969783) is 1-methylcarbazol-4-one.
What is the SMILES notation for 1-methylcarbazol-4-one?
The canonical SMILES for 1-methylcarbazol-4-one is CC1=C2N=c3ccccc3=C2C(=O)C=C1.
What is the InChIKey of 1-methylcarbazol-4-one?
The InChIKey is VNHXNDULTGGTII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO/c1-8-6-7-11(15)12-9-4-2-3-5-10(9)14-13(8)12/h2-7H,1H3.
What are the key properties of 1-methylcarbazol-4-one?
1-methylcarbazol-4-one has a molecular weight of 195.22 g/mol, XLogP of 0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcarbazol-4-one is sourced from PubChem (CID 19969783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).