C8H18N2O — CID 19969877
4-ethoxy-N,N-dimethylpyrrolidin-3-amine (PubChem CID 19969877) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is 4-ethoxy-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 4-ethoxy-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 19969877 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 4-ethoxy-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CCOC1CNCC1N(C)C |
| InChI | InChI=1S/C8H18N2O/c1-4-11-8-6-9-5-7(8)10(2)3/h7-9H,4-6H2,1-3H3 |
| InChIKey | WQBQWAQLYCFXSD-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |