C24H34ClN5O4S — CID 19970302
ethyl 3-[[1-(2-ethoxy-2-oxoethyl)piperidin-4-yl]-[4-[4-[(E)-hydrazinylidenemethyl]phenyl]-1,3-thiazol-2-yl]amino]propanoate;hydrochloride (PubChem CID 19970302) has the molecular formula C24H34ClN5O4S and a molecular weight of 524.09 g/mol. Its IUPAC name is ethyl 3-[[1-(2-ethoxy-2-oxoethyl)piperidin-4-yl]-[4-[4-[(E)-hydrazinylidenemethyl]phenyl]-1,3-thiazol-2-yl]amino]propanoate;hydrochloride.
| Compound Name | ethyl 3-[[1-(2-ethoxy-2-oxoethyl)piperidin-4-yl]-[4-[4-[(E)-hydrazinylidenemethyl]phenyl]-1,3-thiazol-2-yl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 19970302 |
| Molecular Formula | C24H34ClN5O4S |
| Molecular Weight | 524.09 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | ethyl 3-[[1-(2-ethoxy-2-oxoethyl)piperidin-4-yl]-[4-[4-[(E)-hydrazinylidenemethyl]phenyl]-1,3-thiazol-2-yl]amino]propanoate;hydrochloride |
| SMILES | CCOC(=O)CCN(c1nc(-c2ccc(/C=N/N)cc2)cs1)C1CCN(CC(=O)OCC)CC1.Cl |
| InChI | InChI=1S/C24H33N5O4S.ClH/c1-3-32-22(30)11-14-29(20-9-12-28(13-10-20)16-23(31)33-4-2)24-27-21(17-34-24)19-7-5-18(6-8-19)15-26-25;/h5-8,15,17,20H,3-4,9-14,16,25H2,1-2H3;1H/b26-15+; |
| InChIKey | CSHKHISCIZXXKI-UUXIZDQESA-N |
| XLogP | 3.31 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.09 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|