C11H17ClN4O4S — CID 19977508
ethyl 3-(hydrazinylmethylideneamino)-4-(methanesulfonamido)benzoate;hydrochloride (PubChem CID 19977508) has the molecular formula C11H17ClN4O4S and a molecular weight of 336.80 g/mol. Its IUPAC name is ethyl 3-(hydrazinylmethylideneamino)-4-(methanesulfonamido)benzoate;hydrochloride.
| Compound Name | ethyl 3-(hydrazinylmethylideneamino)-4-(methanesulfonamido)benzoate;hydrochloride |
|---|---|
| PubChem CID | 19977508 |
| Molecular Formula | C11H17ClN4O4S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | ethyl 3-(hydrazinylmethylideneamino)-4-(methanesulfonamido)benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(NS(C)(=O)=O)c(/N=C/NN)c1.Cl |
| InChI | InChI=1S/C11H16N4O4S.ClH/c1-3-19-11(16)8-4-5-9(15-20(2,17)18)10(6-8)13-7-14-12;/h4-7,15H,3,12H2,1-2H3,(H,13,14);1H |
| InChIKey | WZMVMKJCKNBTRQ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|