C33H31N3O10 — CID 19980525
5-O-ethyl 3-O-methyl 2-methyl-6-[3-(4-nitrobenzoyl)oxy-3-phenylpropyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 19980525) has the molecular formula C33H31N3O10 and a molecular weight of 629.62 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 2-methyl-6-[3-(4-nitrobenzoyl)oxy-3-phenylpropyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 2-methyl-6-[3-(4-nitrobenzoyl)oxy-3-phenylpropyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 19980525 |
| Molecular Formula | C33H31N3O10 |
| Molecular Weight | 629.62 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 2-methyl-6-[3-(4-nitrobenzoyl)oxy-3-phenylpropyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(CCC(OC(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc2)NC(C)=C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H31N3O10/c1-4-45-33(39)30-26(34-20(2)28(32(38)44-3)29(30)23-11-8-12-25(19-23)36(42)43)17-18-27(21-9-6-5-7-10-21)46-31(37)22-13-15-24(16-14-22)35(40)41/h5-16,19,27,29,34H,4,17-18H2,1-3H3 |
| InChIKey | VBWXFAPYUWGFMV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 177.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|