C24H24ClN3O6 — CID 19980516
ethyl 2-(3-chloro-3-phenylpropyl)-6-methyl-5-nitro-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 19980516) has the molecular formula C24H24ClN3O6 and a molecular weight of 485.92 g/mol. Its IUPAC name is ethyl 2-(3-chloro-3-phenylpropyl)-6-methyl-5-nitro-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl 2-(3-chloro-3-phenylpropyl)-6-methyl-5-nitro-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 19980516 |
| Molecular Formula | C24H24ClN3O6 |
| Molecular Weight | 485.92 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | ethyl 2-(3-chloro-3-phenylpropyl)-6-methyl-5-nitro-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(CCC(Cl)c2ccccc2)NC(C)=C([N+](=O)[O-])C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H24ClN3O6/c1-3-34-24(29)22-20(13-12-19(25)16-8-5-4-6-9-16)26-15(2)23(28(32)33)21(22)17-10-7-11-18(14-17)27(30)31/h4-11,14,19,21,26H,3,12-13H2,1-2H3 |
| InChIKey | XJSKSEZDDDOUMO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.92 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|