C25H27N5O9S — CID 159479381
[amino-[[3-ethoxycarbonyl-6-methyl-5-nitro-4-(3-nitrophenyl)-1,4-dihydropyridin-2-yl]methylsulfanyl]methylidene]azanium;(2S)-2-hydroxy-2-phenylacetate (PubChem CID 159479381) has the molecular formula C25H27N5O9S and a molecular weight of 573.58 g/mol. Its IUPAC name is [amino-[[3-ethoxycarbonyl-6-methyl-5-nitro-4-(3-nitrophenyl)-1,4-dihydropyridin-2-yl]methylsulfanyl]methylidene]azanium;(2S)-2-hydroxy-2-phenylacetate.
| Compound Name | [amino-[[3-ethoxycarbonyl-6-methyl-5-nitro-4-(3-nitrophenyl)-1,4-dihydropyridin-2-yl]methylsulfanyl]methylidene]azanium;(2S)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 159479381 |
| Molecular Formula | C25H27N5O9S |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | [amino-[[3-ethoxycarbonyl-6-methyl-5-nitro-4-(3-nitrophenyl)-1,4-dihydropyridin-2-yl]methylsulfanyl]methylidene]azanium;(2S)-2-hydroxy-2-phenylacetate |
| SMILES | CCOC(=O)C1=C(CSC(N)=[NH2+])NC(C)=C([N+](=O)[O-])C1c1cccc([N+](=O)[O-])c1.O=C([O-])[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H19N5O6S.C8H8O3/c1-3-28-16(23)14-12(8-29-17(18)19)20-9(2)15(22(26)27)13(14)10-5-4-6-11(7-10)21(24)25;9-7(8(10)11)6-4-2-1-3-5-6/h4-7,13,20H,3,8H2,1-2H3,(H3,18,19);1-5,7,9H,(H,10,11)/t;7-/m.0/s1 |
| InChIKey | LWUQCKLYGPPZCR-ZLTKDMPESA-N |
| XLogP | -0.12 |
| TPSA | 236.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|