C22H26N4O6S — CID 19796455
diethyl 2-(4,5-dihydro-1H-imidazol-2-ylsulfanylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 19796455) has the molecular formula C22H26N4O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is diethyl 2-(4,5-dihydro-1H-imidazol-2-ylsulfanylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-(4,5-dihydro-1H-imidazol-2-ylsulfanylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 19796455 |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | diethyl 2-(4,5-dihydro-1H-imidazol-2-ylsulfanylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(CSC2=NCCN2)=C(C(=O)OCC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H26N4O6S/c1-4-31-20(27)17-13(3)25-16(12-33-22-23-9-10-24-22)19(21(28)32-5-2)18(17)14-7-6-8-15(11-14)26(29)30/h6-8,11,18,25H,4-5,9-10,12H2,1-3H3,(H,23,24) |
| InChIKey | FRHAHOKQSJVXQX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|