C27H29Cl2N5O6 — CID 68591198
N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 68591198) has the molecular formula C27H29Cl2N5O6 and a molecular weight of 590.46 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 68591198 |
| Molecular Formula | C27H29Cl2N5O6 |
| Molecular Weight | 590.46 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1.Clc1cccc(Cl)c1NC1=NCCN1 |
| InChI | InChI=1S/C18H20N2O6.C9H9Cl2N3/c1-5-26-18(22)15-11(3)19-10(2)14(17(21)25-4)16(15)12-7-6-8-13(9-12)20(23)24;10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h6-9,16,19H,5H2,1-4H3;1-3H,4-5H2,(H2,12,13,14) |
| InChIKey | KJSRZHNBHLMELN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|