C26H27BrN2O5 — CID 88519368
ethyl 2-(3-bromo-3-phenylpropyl)-6-methyl-4-(3-nitrophenyl)-5-(2-oxoethyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 88519368) has the molecular formula C26H27BrN2O5 and a molecular weight of 527.42 g/mol. Its IUPAC name is ethyl 2-(3-bromo-3-phenylpropyl)-6-methyl-4-(3-nitrophenyl)-5-(2-oxoethyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl 2-(3-bromo-3-phenylpropyl)-6-methyl-4-(3-nitrophenyl)-5-(2-oxoethyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 88519368 |
| Molecular Formula | C26H27BrN2O5 |
| Molecular Weight | 527.42 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | ethyl 2-(3-bromo-3-phenylpropyl)-6-methyl-4-(3-nitrophenyl)-5-(2-oxoethyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(CCC(Br)c2ccccc2)NC(C)=C(CC=O)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H27BrN2O5/c1-3-34-26(31)25-23(13-12-22(27)18-8-5-4-6-9-18)28-17(2)21(14-15-30)24(25)19-10-7-11-20(16-19)29(32)33/h4-11,15-16,22,24,28H,3,12-14H2,1-2H3 |
| InChIKey | NQMTTWMBBQEVDH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.42 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|