About CID 19982704
CID 19982704 (PubChem CID 19982704) has the molecular formula C16H28OSi2
and a molecular weight of 292.57 g/mol.
Molecular Properties
| Compound Name | CID 19982704 |
| PubChem CID | 19982704 |
| Molecular Formula | C16H28OSi2 |
| Molecular Weight | 292.57 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | — |
| SMILES | [Si]CCCCCC/C=C/O/C=C/CCCCCC[Si] |
| InChI | InChI=1S/C16H28OSi2/c18-15-11-7-3-1-5-9-13-17-14-10-6-2-4-8-12-16-19/h9-10,13-14H,1-8,11-12,15-16H2/b13-9+,14-10+ |
| InChIKey | MJERNOJHYFMJAX-UTLPMFLDSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19982704 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19982704?
The IUPAC name of CID 19982704 (CID 19982704) is not available.
What is the SMILES notation for CID 19982704?
The canonical SMILES for CID 19982704 is [Si]CCCCCC/C=C/O/C=C/CCCCCC[Si].
What is the InChIKey of CID 19982704?
The InChIKey is MJERNOJHYFMJAX-UTLPMFLDSA-N. The full InChI is InChI=1S/C16H28OSi2/c18-15-11-7-3-1-5-9-13-17-14-10-6-2-4-8-12-16-19/h9-10,13-14H,1-8,11-12,15-16H2/b13-9+,14-10+.
What are the key properties of CID 19982704?
CID 19982704 has a molecular weight of 292.57 g/mol, XLogP of 5.11, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19982704 is sourced from PubChem (CID 19982704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).