C28H54O — CID 139610664
1-(11,11-dimethyldodec-1-enoxy)-11,11-dimethyldodec-1-ene (PubChem CID 139610664) has the molecular formula C28H54O and a molecular weight of 406.74 g/mol. Its IUPAC name is 1-(11,11-dimethyldodec-1-enoxy)-11,11-dimethyldodec-1-ene.
| Compound Name | 1-(11,11-dimethyldodec-1-enoxy)-11,11-dimethyldodec-1-ene |
|---|---|
| PubChem CID | 139610664 |
| Molecular Formula | C28H54O |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.42 |
| IUPAC Name | 1-(11,11-dimethyldodec-1-enoxy)-11,11-dimethyldodec-1-ene |
| SMILES | CC(C)(C)CCCCCCCCC=COC=CCCCCCCCCC(C)(C)C |
| InChI | InChI=1S/C28H54O/c1-27(2,3)23-19-15-11-7-9-13-17-21-25-29-26-22-18-14-10-8-12-16-20-24-28(4,5)6/h21-22,25-26H,7-20,23-24H2,1-6H3 |
| InChIKey | ZTAFDILXRJUBOA-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|