C23H30ClNO4 — CID 19983193
ethyl 4-[3-(4-benzylmorpholin-2-yl)propoxy]benzoate;hydrochloride (PubChem CID 19983193) has the molecular formula C23H30ClNO4 and a molecular weight of 419.95 g/mol. Its IUPAC name is ethyl 4-[3-(4-benzylmorpholin-2-yl)propoxy]benzoate;hydrochloride.
| Compound Name | ethyl 4-[3-(4-benzylmorpholin-2-yl)propoxy]benzoate;hydrochloride |
|---|---|
| PubChem CID | 19983193 |
| Molecular Formula | C23H30ClNO4 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | ethyl 4-[3-(4-benzylmorpholin-2-yl)propoxy]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(OCCCC2CN(Cc3ccccc3)CCO2)cc1.Cl |
| InChI | InChI=1S/C23H29NO4.ClH/c1-2-26-23(25)20-10-12-21(13-11-20)27-15-6-9-22-18-24(14-16-28-22)17-19-7-4-3-5-8-19;/h3-5,7-8,10-13,22H,2,6,9,14-18H2,1H3;1H |
| InChIKey | BLFQXRRTUGAZNG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|