C23H25N3O5 — CID 56586482
(4-benzylmorpholin-2-yl)methyl 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylate (PubChem CID 56586482) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is (4-benzylmorpholin-2-yl)methyl 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylate.
| Compound Name | (4-benzylmorpholin-2-yl)methyl 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 56586482 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (4-benzylmorpholin-2-yl)methyl 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylate |
| SMILES | CCn1c(=O)[nH]c2cc(C(=O)OCC3CN(Cc4ccccc4)CCO3)ccc2c1=O |
| InChI | InChI=1S/C23H25N3O5/c1-2-26-21(27)19-9-8-17(12-20(19)24-23(26)29)22(28)31-15-18-14-25(10-11-30-18)13-16-6-4-3-5-7-16/h3-9,12,18H,2,10-11,13-15H2,1H3,(H,24,29) |
| InChIKey | BCSDDZDQCPGIQL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |