C22H22N4O5 — CID 78765888
(4-benzylmorpholin-2-yl)methyl 4-imidazol-1-yl-3-nitrobenzoate (PubChem CID 78765888) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is (4-benzylmorpholin-2-yl)methyl 4-imidazol-1-yl-3-nitrobenzoate.
| Compound Name | (4-benzylmorpholin-2-yl)methyl 4-imidazol-1-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 78765888 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (4-benzylmorpholin-2-yl)methyl 4-imidazol-1-yl-3-nitrobenzoate |
| SMILES | O=C(OCC1CN(Cc2ccccc2)CCO1)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22N4O5/c27-22(18-6-7-20(21(12-18)26(28)29)25-9-8-23-16-25)31-15-19-14-24(10-11-30-19)13-17-4-2-1-3-5-17/h1-9,12,16,19H,10-11,13-15H2 |
| InChIKey | INCJYRVIKURQQJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|