C23H32O — CID 19983735
1-[2-(4-hexylcyclohexen-1-yl)ethynyl]-4-propoxybenzene (PubChem CID 19983735) has the molecular formula C23H32O and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-[2-(4-hexylcyclohexen-1-yl)ethynyl]-4-propoxybenzene.
| Compound Name | 1-[2-(4-hexylcyclohexen-1-yl)ethynyl]-4-propoxybenzene |
|---|---|
| PubChem CID | 19983735 |
| Molecular Formula | C23H32O |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 1-[2-(4-hexylcyclohexen-1-yl)ethynyl]-4-propoxybenzene |
| SMILES | CCCCCCC1CC=C(C#Cc2ccc(OCCC)cc2)CC1 |
| InChI | InChI=1S/C23H32O/c1-3-5-6-7-8-20-9-11-21(12-10-20)13-14-22-15-17-23(18-16-22)24-19-4-2/h11,15-18,20H,3-10,12,19H2,1-2H3 |
| InChIKey | CMEXZCYSKKDJQT-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|