C23H32 — CID 19984034
1-[2-(4-butylcyclohexen-1-yl)ethynyl]-4-pentylbenzene (PubChem CID 19984034) has the molecular formula C23H32 and a molecular weight of 308.51 g/mol. Its IUPAC name is 1-[2-(4-butylcyclohexen-1-yl)ethynyl]-4-pentylbenzene.
| Compound Name | 1-[2-(4-butylcyclohexen-1-yl)ethynyl]-4-pentylbenzene |
|---|---|
| PubChem CID | 19984034 |
| Molecular Formula | C23H32 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 1-[2-(4-butylcyclohexen-1-yl)ethynyl]-4-pentylbenzene |
| SMILES | CCCCCc1ccc(C#CC2=CCC(CCCC)CC2)cc1 |
| InChI | InChI=1S/C23H32/c1-3-5-7-9-21-12-16-23(17-13-21)19-18-22-14-10-20(11-15-22)8-6-4-2/h12-14,16-17,20H,3-11,15H2,1-2H3 |
| InChIKey | UGJDALATZKLRRK-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|