C17H23F2NO3 — CID 19986498
ethyl 6-[(2,4-difluorophenyl)methyl-ethylamino]-6-oxohexanoate (PubChem CID 19986498) has the molecular formula C17H23F2NO3 and a molecular weight of 327.37 g/mol. Its IUPAC name is ethyl 6-[(2,4-difluorophenyl)methyl-ethylamino]-6-oxohexanoate.
| Compound Name | ethyl 6-[(2,4-difluorophenyl)methyl-ethylamino]-6-oxohexanoate |
|---|---|
| PubChem CID | 19986498 |
| Molecular Formula | C17H23F2NO3 |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | ethyl 6-[(2,4-difluorophenyl)methyl-ethylamino]-6-oxohexanoate |
| SMILES | CCOC(=O)CCCCC(=O)N(CC)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C17H23F2NO3/c1-3-20(12-13-9-10-14(18)11-15(13)19)16(21)7-5-6-8-17(22)23-4-2/h9-11H,3-8,12H2,1-2H3 |
| InChIKey | ZRPDRUCRKOWZOX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|