C10H9Cl2O2- — CID 19987881
2-[4-(1,1-dichloroethyl)phenyl]acetate (PubChem CID 19987881) has the molecular formula C10H9Cl2O2- and a molecular weight of 232.09 g/mol. Its IUPAC name is 2-[4-(1,1-dichloroethyl)phenyl]acetate.
| Compound Name | 2-[4-(1,1-dichloroethyl)phenyl]acetate |
|---|---|
| PubChem CID | 19987881 |
| Molecular Formula | C10H9Cl2O2- |
| Molecular Weight | 232.09 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | 2-[4-(1,1-dichloroethyl)phenyl]acetate |
| SMILES | CC(Cl)(Cl)c1ccc(CC(=O)[O-])cc1 |
| InChI | InChI=1S/C10H10Cl2O2/c1-10(11,12)8-4-2-7(3-5-8)6-9(13)14/h2-5H,6H2,1H3,(H,13,14)/p-1 |
| InChIKey | ROGJHPYMNREYKD-UHFFFAOYSA-M |
| XLogP | 1.63 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.09 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|