C14H18NO4P — CID 19995245
3-(2-phenyl-1,3-oxazol-5-yl)pentan-3-ylphosphonic acid (PubChem CID 19995245) has the molecular formula C14H18NO4P and a molecular weight of 295.27 g/mol. Its IUPAC name is 3-(2-phenyl-1,3-oxazol-5-yl)pentan-3-ylphosphonic acid.
| Compound Name | 3-(2-phenyl-1,3-oxazol-5-yl)pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 19995245 |
| Molecular Formula | C14H18NO4P |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-(2-phenyl-1,3-oxazol-5-yl)pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(c1cnc(-c2ccccc2)o1)P(=O)(O)O |
| InChI | InChI=1S/C14H18NO4P/c1-3-14(4-2,20(16,17)18)12-10-15-13(19-12)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3,(H2,16,17,18) |
| InChIKey | DAVZHINVYPNVLN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|