C12H13NO3 — CID 177437797
5-(dimethoxymethyl)-2-phenyl-1,3-oxazole (PubChem CID 177437797) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 5-(dimethoxymethyl)-2-phenyl-1,3-oxazole.
| Compound Name | 5-(dimethoxymethyl)-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 177437797 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 5-(dimethoxymethyl)-2-phenyl-1,3-oxazole |
| SMILES | COC(OC)c1cnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C12H13NO3/c1-14-12(15-2)10-8-13-11(16-10)9-6-4-3-5-7-9/h3-8,12H,1-2H3 |
| InChIKey | DPKLLYIBLHGHMH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|