C16H14N2O — CID 575782
N-methyl-N,2-diphenyl-1,3-oxazol-5-amine (PubChem CID 575782) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is N-methyl-N,2-diphenyl-1,3-oxazol-5-amine.
| Compound Name | N-methyl-N,2-diphenyl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 575782 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-methyl-N,2-diphenyl-1,3-oxazol-5-amine |
| SMILES | CN(c1ccccc1)c1cnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H14N2O/c1-18(14-10-6-3-7-11-14)15-12-17-16(19-15)13-8-4-2-5-9-13/h2-12H,1H3 |
| InChIKey | SIIKUBKXRGBIPG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |