C14H17IN2O — CID 19996579
1-[6-iodo-4-(methylamino)-2a,3,4,5-tetrahydro-2H-benzo[cd]indol-1-yl]ethanone (PubChem CID 19996579) has the molecular formula C14H17IN2O and a molecular weight of 356.21 g/mol. Its IUPAC name is 1-[6-iodo-4-(methylamino)-2a,3,4,5-tetrahydro-2H-benzo[cd]indol-1-yl]ethanone.
| Compound Name | 1-[6-iodo-4-(methylamino)-2a,3,4,5-tetrahydro-2H-benzo[cd]indol-1-yl]ethanone |
|---|---|
| PubChem CID | 19996579 |
| Molecular Formula | C14H17IN2O |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 1-[6-iodo-4-(methylamino)-2a,3,4,5-tetrahydro-2H-benzo[cd]indol-1-yl]ethanone |
| SMILES | CNC1Cc2c(I)ccc3c2C(C1)CN3C(C)=O |
| InChI | InChI=1S/C14H17IN2O/c1-8(18)17-7-9-5-10(16-2)6-11-12(15)3-4-13(17)14(9)11/h3-4,9-10,16H,5-7H2,1-2H3 |
| InChIKey | ZUUMJRJGZSSDRS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|