C18H22N2O — CID 10636645
1-[(4R,7R,9S)-4,6-dimethyl-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),2,12,14-tetraen-11-yl]ethanone (PubChem CID 10636645) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-[(4R,7R,9S)-4,6-dimethyl-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),2,12,14-tetraen-11-yl]ethanone.
| Compound Name | 1-[(4R,7R,9S)-4,6-dimethyl-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),2,12,14-tetraen-11-yl]ethanone |
|---|---|
| PubChem CID | 10636645 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-[(4R,7R,9S)-4,6-dimethyl-6,11-diazatetracyclo[7.6.1.03,7.012,16]hexadeca-1(16),2,12,14-tetraen-11-yl]ethanone |
| SMILES | CC(=O)N1C[C@H]2C[C@@H]3C(=Cc4cccc1c42)[C@@H](C)CN3C |
| InChI | InChI=1S/C18H22N2O/c1-11-9-19(3)17-8-14-10-20(12(2)21)16-6-4-5-13(18(14)16)7-15(11)17/h4-7,11,14,17H,8-10H2,1-3H3/t11-,14+,17+/m0/s1 |
| InChIKey | JDSYGKPMXZYAPQ-FABXCBLPSA-N |
| XLogP | 2.87 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |