About 2-bromobenzonitrile
2-bromobenzonitrile (PubChem CID 16272) has the molecular formula C7H4BrN
and a molecular weight of 182.02 g/mol. Its IUPAC name is 2-bromobenzonitrile.
Molecular Properties
| Compound Name | 2-bromobenzonitrile |
| PubChem CID | 16272 |
| Molecular Formula | C7H4BrN |
| Molecular Weight | 182.02 g/mol |
| Exact Mass | 180.95 |
| IUPAC Name | 2-bromobenzonitrile |
| SMILES | N#Cc1ccccc1Br |
| InChI | InChI=1S/C7H4BrN/c8-7-4-2-1-3-6(7)5-9/h1-4H |
| InChIKey | AFMPMSCZPVNPEM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.02 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobenzonitrile?
The IUPAC name of 2-bromobenzonitrile (CID 16272) is 2-bromobenzonitrile.
What is the SMILES notation for 2-bromobenzonitrile?
The canonical SMILES for 2-bromobenzonitrile is N#Cc1ccccc1Br.
What is the InChIKey of 2-bromobenzonitrile?
The InChIKey is AFMPMSCZPVNPEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrN/c8-7-4-2-1-3-6(7)5-9/h1-4H.
What are the key properties of 2-bromobenzonitrile?
2-bromobenzonitrile has a molecular weight of 182.02 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobenzonitrile is sourced from PubChem (CID 16272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).