About 2-hydroxybenzamide
2-hydroxybenzamide (PubChem CID 5147) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 2-hydroxybenzamide.
Molecular Properties
| Compound Name | 2-hydroxybenzamide |
| PubChem CID | 5147 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 2-hydroxybenzamide |
| SMILES | NC(=O)c1ccccc1O |
| InChI | InChI=1S/C7H7NO2/c8-7(10)5-3-1-2-4-6(5)9/h1-4,9H,(H2,8,10) |
| InChIKey | SKZKKFZAGNVIMN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzamide?
The IUPAC name of 2-hydroxybenzamide (CID 5147) is 2-hydroxybenzamide.
What is the SMILES notation for 2-hydroxybenzamide?
The canonical SMILES for 2-hydroxybenzamide is NC(=O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzamide?
The InChIKey is SKZKKFZAGNVIMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c8-7(10)5-3-1-2-4-6(5)9/h1-4,9H,(H2,8,10).
What are the key properties of 2-hydroxybenzamide?
2-hydroxybenzamide has a molecular weight of 137.14 g/mol, XLogP of 0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzamide is sourced from PubChem (CID 5147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).