C24H28N4O2 — CID 2001967
(4R)-7,7-dimethyl-2-[(4-methylpiperazin-1-yl)methylideneamino]-5-oxo-4-phenyl-6,8-dihydro-4H-chromene-3-carbonitrile (PubChem CID 2001967) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (4R)-7,7-dimethyl-2-[(4-methylpiperazin-1-yl)methylideneamino]-5-oxo-4-phenyl-6,8-dihydro-4H-chromene-3-carbonitrile.
| Compound Name | (4R)-7,7-dimethyl-2-[(4-methylpiperazin-1-yl)methylideneamino]-5-oxo-4-phenyl-6,8-dihydro-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 2001967 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (4R)-7,7-dimethyl-2-[(4-methylpiperazin-1-yl)methylideneamino]-5-oxo-4-phenyl-6,8-dihydro-4H-chromene-3-carbonitrile |
| SMILES | CN1CCN(C=NC2=C(C#N)[C@@H](c3ccccc3)C3=C(CC(C)(C)CC3=O)O2)CC1 |
| InChI | InChI=1S/C24H28N4O2/c1-24(2)13-19(29)22-20(14-24)30-23(26-16-28-11-9-27(3)10-12-28)18(15-25)21(22)17-7-5-4-6-8-17/h4-8,16,21H,9-14H2,1-3H3/t21-/m1/s1 |
| InChIKey | YYKGEQLXOIOEML-OAQYLSRUSA-N |
| XLogP | 3.45 |
| TPSA | 68.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|