C16H14NO5S- — CID 2011222
3-[(5E)-2,4-dioxo-5-[(4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanoate (PubChem CID 2011222) has the molecular formula C16H14NO5S- and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-[(5E)-2,4-dioxo-5-[(4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | 3-[(5E)-2,4-dioxo-5-[(4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 2011222 |
| Molecular Formula | C16H14NO5S- |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 3-[(5E)-2,4-dioxo-5-[(4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]propanoate |
| SMILES | C=CCOc1ccc(/C=C2/SC(=O)N(CCC(=O)[O-])C2=O)cc1 |
| InChI | InChI=1S/C16H15NO5S/c1-2-9-22-12-5-3-11(4-6-12)10-13-15(20)17(16(21)23-13)8-7-14(18)19/h2-6,10H,1,7-9H2,(H,18,19)/p-1/b13-10+ |
| InChIKey | URJUWZQVWLZVRG-JLHYYAGUSA-M |
| XLogP | 1.43 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|