C13H7F3NO5S- — CID 154038060
2-[2,4-dioxo-5-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetate (PubChem CID 154038060) has the molecular formula C13H7F3NO5S- and a molecular weight of 346.26 g/mol. Its IUPAC name is 2-[2,4-dioxo-5-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-[2,4-dioxo-5-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 154038060 |
| Molecular Formula | C13H7F3NO5S- |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 2-[2,4-dioxo-5-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetate |
| SMILES | O=C([O-])CN1C(=O)SC(=Cc2ccc(OC(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C13H8F3NO5S/c14-13(15,16)22-8-3-1-7(2-4-8)5-9-11(20)17(6-10(18)19)12(21)23-9/h1-5H,6H2,(H,18,19)/p-1 |
| InChIKey | RNPVYZVKXWZGEU-UHFFFAOYSA-M |
| XLogP | 1.37 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|