C14H11NO5S — CID 160689702
[4-[(Z)-[2,4-dioxo-3-(2-oxopropyl)-1,3-thiazolidin-5-ylidene]methyl]phenyl] formate (PubChem CID 160689702) has the molecular formula C14H11NO5S and a molecular weight of 305.31 g/mol. Its IUPAC name is [4-[(Z)-[2,4-dioxo-3-(2-oxopropyl)-1,3-thiazolidin-5-ylidene]methyl]phenyl] formate.
| Compound Name | [4-[(Z)-[2,4-dioxo-3-(2-oxopropyl)-1,3-thiazolidin-5-ylidene]methyl]phenyl] formate |
|---|---|
| PubChem CID | 160689702 |
| Molecular Formula | C14H11NO5S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | [4-[(Z)-[2,4-dioxo-3-(2-oxopropyl)-1,3-thiazolidin-5-ylidene]methyl]phenyl] formate |
| SMILES | CC(=O)CN1C(=O)S/C(=C\c2ccc(OC=O)cc2)C1=O |
| InChI | InChI=1S/C14H11NO5S/c1-9(17)7-15-13(18)12(21-14(15)19)6-10-2-4-11(5-3-10)20-8-16/h2-6,8H,7H2,1H3/b12-6- |
| InChIKey | HBBJGNCNKNLQTB-SDQBBNPISA-N |
| XLogP | 1.85 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|