About 2-ethylhexanamide
2-ethylhexanamide (PubChem CID 20125) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-ethylhexanamide.
Molecular Properties
| Compound Name | 2-ethylhexanamide |
| PubChem CID | 20125 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-ethylhexanamide |
| SMILES | CCCCC(CC)C(N)=O |
| InChI | InChI=1S/C8H17NO/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H2,9,10) |
| InChIKey | GMORVOQOIHISPT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanamide?
The IUPAC name of 2-ethylhexanamide (CID 20125) is 2-ethylhexanamide.
What is the SMILES notation for 2-ethylhexanamide?
The canonical SMILES for 2-ethylhexanamide is CCCCC(CC)C(N)=O.
What is the InChIKey of 2-ethylhexanamide?
The InChIKey is GMORVOQOIHISPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H2,9,10).
What are the key properties of 2-ethylhexanamide?
2-ethylhexanamide has a molecular weight of 143.23 g/mol, XLogP of 1.69, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanamide is sourced from PubChem (CID 20125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).